solo per uso di ricerca
N. Cat.S1149
| Target correlati | HDAC PARP ATM/ATR DNA-PK WRN Topoisomerase PPAR Sirtuin Casein Kinase eIF |
|---|---|
| Altro DNA/RNA Synthesis Inibitori | CX-5461 (Pidnarulex) B02 SCR7 Favipiravir (T-705) EED226 RK-33 BMH-21 Triapine (3-AP) Carmofur YK-4-279 |
| Linee cellulari | Tipo di saggio | Concentrazione | Tempo di incubazione | Formulazione | Descrizione dellattività | PMID |
|---|---|---|---|---|---|---|
| CCRF-CEM | Growth Inhibition Assay | IC50=2.9 ± 1.8 nM | 22425885 | |||
| CCRF-CEM/dCK−/− | Growth Inhibition Assay | IC50=240.4 ± 29.0 μM | 22425885 | |||
| L1210 wt | Growth Inhibition Assay | IC50=1.3 ± 0.3 nM | 22425885 | |||
| L1210 10K | Growth Inhibition Assay | IC50=22.2 ± 3.7 μM | 22425885 | |||
| TC-1 | Growth Inhibition Assay | IC50=14.7 ± 2.8 nM | 22425885 | |||
| TC-1-GR | Growth Inhibition Assay | IC50=36.7 ± 5.1 μM | 22425885 | |||
| MIA PaCa-2 | Growth Inhibition Assay | IC50=49.7 ± 17.7 nM | 22425885 | |||
| PANC-1 | Growth Inhibition Assay | IC50=> 400 μM | 22425885 | |||
| CCRF-CEM | Growth Inhibition Assay | IC50=2.9 ± 1.8 nM | 22425885 | |||
| CCRF-CEM-AraC-8C | Growth Inhibition Assay | IC50=998.8 ± 9.4 nM | 22425885 | |||
| CCRF-CEM | Growth Inhibition Assay | 72 h | IC50=2.0 ± 0.6 nM | 21851843 | ||
| MV-4-11 | Growth inhibition assay | IC50 = 0.0005 nM | SANGER | |||
| ES4 | Growth inhibition assay | IC50 = 0.0007 nM | SANGER | |||
| ACHN | Growth inhibition assay | IC50 = 0.0009 nM | SANGER | |||
| KYSE-510 | Growth inhibition assay | IC50 = 0.001 nM | SANGER | |||
| EW-7 | Growth inhibition assay | IC50 = 0.0026 nM | SANGER | |||
| BFTC-905 | Growth inhibition assay | IC50 = 0.0051 nM | SANGER | |||
| KE-37 | Growth inhibition assay | IC50 = 0.0056 nM | SANGER | |||
| SBC-5 | Growth inhibition assay | IC50 = 0.0057 nM | SANGER | |||
| NKM-1 | Growth inhibition assay | IC50 = 0.0071 nM | SANGER | |||
| RH-1 | Growth inhibition assay | IC50 = 0.0072 nM | SANGER | |||
| ALL-PO | Growth inhibition assay | IC50 = 0.0083 nM | SANGER | |||
| QIMR-WIL | Growth inhibition assay | IC50 = 0.0089 nM | SANGER | |||
| A375 | Growth inhibition assay | IC50 = 0.0099 nM | SANGER | |||
| SIG-M5 | Growth inhibition assay | IC50 = 0.0104 nM | SANGER | |||
| KGN | Growth inhibition assay | IC50 = 0.0108 nM | SANGER | |||
| EW-13 | Growth inhibition assay | IC50 = 0.0112 nM | SANGER | |||
| NCI-SNU-1 | Growth inhibition assay | IC50 = 0.016 nM | SANGER | |||
| PSN1 | Growth inhibition assay | IC50 = 0.0165 nM | SANGER | |||
| HUTU-80 | Growth inhibition assay | IC50 = 0.0166 nM | SANGER | |||
| 786-0 | Growth inhibition assay | IC50 = 0.023 nM | SANGER | |||
| EW-16 | Growth inhibition assay | IC50 = 0.023 nM | SANGER | |||
| ES1 | Growth inhibition assay | IC50 = 0.0268 nM | SANGER | |||
| RKO | Growth inhibition assay | IC50 = 0.0278 nM | SANGER | |||
| ESS-1 | Growth inhibition assay | IC50 = 0.0286 nM | SANGER | |||
| SK-UT-1 | Growth inhibition assay | IC50 = 0.0297 nM | SANGER | |||
| LB2241-RCC | Growth inhibition assay | IC50 = 0.0318 nM | SANGER | |||
| CHL-1 | Growth inhibition assay | IC50 = 0.0324 nM | SANGER | |||
| SW1783 | Growth inhibition assay | IC50 = 0.0336 nM | SANGER | |||
| MEL-JUSO | Growth inhibition assay | IC50 = 0.0391 nM | SANGER | |||
| HT-29 | Growth inhibition assay | IC50 = 0.0413 nM | SANGER | |||
| SNG-M | Growth inhibition assay | IC50 = 0.0425 nM | SANGER | |||
| TE-15 | Growth inhibition assay | IC50 = 0.0464 nM | SANGER | |||
| HOS | Growth inhibition assay | IC50 = 0.048 nM | SANGER | |||
| BB65-RCC | Growth inhibition assay | IC50 = 0.0512 nM | SANGER | |||
| HCE-4 | Growth inhibition assay | IC50 = 0.0528 nM | SANGER | |||
| MHH-ES-1 | Growth inhibition assay | IC50 = 0.0531 nM | SANGER | |||
| RPMI-7951 | Growth inhibition assay | IC50 = 0.0541 nM | SANGER | |||
| IST-SL2 | Growth inhibition assay | IC50 = 0.0584 nM | SANGER | |||
| CMK | Growth inhibition assay | IC50 = 0.0586 nM | SANGER | |||
| GR-ST | Growth inhibition assay | IC50 = 0.0595 nM | SANGER | |||
| NALM-6 | Growth inhibition assay | IC50 = 0.0622 nM | SANGER | |||
| RPMI-6666 | Growth inhibition assay | IC50 = 0.0652 nM | SANGER | |||
| LC-2-ad | Growth inhibition assay | IC50 = 0.0653 nM | SANGER | |||
| ARH-77 | Growth inhibition assay | IC50 = 0.0711 nM | SANGER | |||
| IST-MEL1 | Growth inhibition assay | IC50 = 0.0726 nM | SANGER | |||
| SW1710 | Growth inhibition assay | IC50 = 0.0751 nM | SANGER | |||
| DEL | Growth inhibition assay | IC50 = 0.0887 nM | SANGER | |||
| AGS | Growth inhibition assay | IC50 = 0.0902 nM | SANGER | |||
| NCI-H2122 | Growth inhibition assay | IC50 = 0.0945 nM | SANGER | |||
| HSC-4 | Growth inhibition assay | IC50 = 0.1022 nM | SANGER | |||
| AM-38 | Growth inhibition assay | IC50 = 0.1215 nM | SANGER | |||
| 769-P | Growth inhibition assay | IC50 = 0.1231 nM | SANGER | |||
| RT-112 | Growth inhibition assay | IC50 = 0.1273 nM | SANGER | |||
| MCF7 | Growth inhibition assay | IC50 = 0.1359 nM | SANGER | |||
| IGROV-1 | Growth inhibition assay | IC50 = 0.145 nM | SANGER | |||
| OCI-AML2 | Growth inhibition assay | IC50 = 0.1466 nM | SANGER | |||
| NCI-H1299 | Growth inhibition assay | IC50 = 0.1566 nM | SANGER | |||
| A431 | Growth inhibition assay | IC50 = 0.1831 nM | SANGER | |||
| SW982 | Growth inhibition assay | IC50 = 0.2133 nM | SANGER | |||
| BB30-HNC | Growth inhibition assay | IC50 = 0.2312 nM | SANGER | |||
| ACN | Growth inhibition assay | IC50 = 0.2436 nM | SANGER | |||
| 647-V | Growth inhibition assay | IC50 = 0.2481 nM | SANGER | |||
| SK-PN-DW | Growth inhibition assay | IC50 = 0.2656 nM | SANGER | |||
| LCLC-97TM1 | Growth inhibition assay | IC50 = 0.2673 nM | SANGER | |||
| LB1047-RCC | Growth inhibition assay | IC50 = 0.2688 nM | SANGER | |||
| A2780 | Growth inhibition assay | IC50 = 0.2702 nM | SANGER | |||
| C-33-A | Growth inhibition assay | IC50 = 0.2733 nM | SANGER | |||
| NCI-H2228 | Growth inhibition assay | IC50 = 0.314 nM | SANGER | |||
| TE-5 | Growth inhibition assay | IC50 = 0.3157 nM | SANGER | |||
| HC-1 | Growth inhibition assay | IC50 = 0.3273 nM | SANGER | |||
| SK-MES-1 | Growth inhibition assay | IC50 = 0.3279 nM | SANGER | |||
| NCI-H1355 | Growth inhibition assay | IC50 = 0.3806 nM | SANGER | |||
| YKG-1 | Growth inhibition assay | IC50 = 0.4194 nM | SANGER | |||
| RS4-11 | Growth inhibition assay | IC50 = 0.4326 nM | SANGER | |||
| Daoy | Growth inhibition assay | IC50 = 0.4565 nM | SANGER | |||
| A3-KAW | Growth inhibition assay | IC50 = 0.5512 nM | SANGER | |||
| SK-MEL-30 | Growth inhibition assay | IC50 = 0.5545 nM | SANGER | |||
| U031 | Growth inhibition assay | IC50 = 0.5647 nM | SANGER | |||
| SK-LMS-1 | Growth inhibition assay | IC50 = 0.5776 nM | SANGER | |||
| ES6 | Growth inhibition assay | IC50 = 0.5856 nM | SANGER | |||
| EoL-1-cell | Growth inhibition assay | IC50 = 0.6162 nM | SANGER | |||
| NCI-H2009 | Growth inhibition assay | IC50 = 0.6187 nM | SANGER | |||
| A4-Fuk | Growth inhibition assay | IC50 = 0.6263 nM | SANGER | |||
| KYSE-270 | Growth inhibition assay | IC50 = 0.6341 nM | SANGER | |||
| SK-LU-1 | Growth inhibition assay | IC50 = 0.6552 nM | SANGER | |||
| SW872 | Growth inhibition assay | IC50 = 0.7647 nM | SANGER | |||
| ES8 | Growth inhibition assay | IC50 = 0.7802 nM | SANGER | |||
| G-402 | Growth inhibition assay | IC50 = 0.7844 nM | SANGER | |||
| ATN-1 | Growth inhibition assay | IC50 = 0.8069 nM | SANGER | |||
| DoTc2-4510 | Growth inhibition assay | IC50 = 0.9012 nM | SANGER | |||
| MES-SA | Growth inhibition assay | IC50 = 0.9049 nM | SANGER | |||
| SF268 | Growth inhibition assay | IC50 = 0.9274 nM | SANGER | |||
| SF539 | Growth inhibition assay | IC50 = 1.023 nM | SANGER | |||
| NB69 | Growth inhibition assay | IC50 = 1.046 nM | SANGER | |||
| 8505C | Growth inhibition assay | IC50 = 1.063 nM | SANGER | |||
| CAL-12T | Growth inhibition assay | IC50 = 1.084 nM | SANGER | |||
| BHY | Growth inhibition assay | IC50 = 1.141 nM | SANGER | |||
| LB647-SCLC | Growth inhibition assay | IC50 = 1.18 nM | SANGER | |||
| CAL-62 | Growth inhibition assay | IC50 = 1.215 nM | SANGER | |||
| MEG-01 | Growth inhibition assay | IC50 = 1.266 nM | SANGER | |||
| MG-63 | Growth inhibition assay | IC50 = 1.335 nM | SANGER | |||
| SW620 | Growth inhibition assay | IC50 = 1.346 nM | SANGER | |||
| A388 | Growth inhibition assay | IC50 = 1.365 nM | SANGER | |||
| BCPAP | Growth inhibition assay | IC50 = 1.452 nM | SANGER | |||
| P30-OHK | Growth inhibition assay | IC50 = 1.459 nM | SANGER | |||
| Ca9-22 | Growth inhibition assay | IC50 = 1.538 nM | SANGER | |||
| VMRC-RCZ | Growth inhibition assay | IC50 = 1.542 nM | SANGER | |||
| LOXIMVI | Growth inhibition assay | IC50 = 1.596 nM | SANGER | |||
| L-540 | Growth inhibition assay | IC50 = 1.602 nM | SANGER | |||
| NTERA-S-cl-D1 | Growth inhibition assay | IC50 = 1.641 nM | SANGER | |||
| MFH-ino | Growth inhibition assay | IC50 = 1.656 nM | SANGER | |||
| Calu-6 | Growth inhibition assay | IC50 = 1.735 nM | SANGER | |||
| HEL | Growth inhibition assay | IC50 = 1.791 nM | SANGER | |||
| CAL-33 | Growth inhibition assay | IC50 = 1.893 nM | SANGER | |||
| HSC-3 | Growth inhibition assay | IC50 = 1.905 nM | SANGER | |||
| KU812 | Growth inhibition assay | IC50 = 1.913 nM | SANGER | |||
| EB2 | Growth inhibition assay | IC50 = 2.012 nM | SANGER | |||
| SR | Growth inhibition assay | IC50 = 2.121 nM | SANGER | |||
| NCI-H2087 | Growth inhibition assay | IC50 = 2.143 nM | SANGER | |||
| H4 | Growth inhibition assay | IC50 = 2.175 nM | SANGER | |||
| EW-1 | Growth inhibition assay | IC50 = 2.223 nM | SANGER | |||
| MC-IXC | Growth inhibition assay | IC50 = 2.264 nM | SANGER | |||
| NCI-H727 | Growth inhibition assay | IC50 = 2.506 nM | SANGER | |||
| MRK-nu-1 | Growth inhibition assay | IC50 = 2.567 nM | SANGER | |||
| COLO-668 | Growth inhibition assay | IC50 = 2.66 nM | SANGER | |||
| CGTH-W-1 | Growth inhibition assay | IC50 = 2.723 nM | SANGER | |||
| CHP-212 | Growth inhibition assay | IC50 = 2.752 nM | SANGER | |||
| GI-1 | Growth inhibition assay | IC50 = 2.764 nM | SANGER | |||
| HCC1806 | Growth inhibition assay | IC50 = 2.908 nM | SANGER | |||
| HLE | Growth inhibition assay | IC50 = 3.004 nM | SANGER | |||
| HSC-2 | Growth inhibition assay | IC50 = 3.03 nM | SANGER | |||
| DMS-273 | Growth inhibition assay | IC50 = 3.07 nM | SANGER | |||
| DU-4475 | Growth inhibition assay | IC50 = 3.143 nM | SANGER | |||
| LXF-289 | Growth inhibition assay | IC50 = 3.314 nM | SANGER | |||
| PANC-03-27 | Growth inhibition assay | IC50 = 3.513 nM | SANGER | |||
| GAMG | Growth inhibition assay | IC50 = 3.739 nM | SANGER | |||
| NCI-H522 | Growth inhibition assay | IC50 = 4.337 nM | SANGER | |||
| SW626 | Growth inhibition assay | IC50 = 4.464 nM | SANGER | |||
| HT-144 | Growth inhibition assay | IC50 = 4.92 nM | SANGER | |||
| MEL-HO | Growth inhibition assay | IC50 = 5.162 nM | SANGER | |||
| BE-13 | Growth inhibition assay | IC50 = 5.21 nM | SANGER | |||
| VA-ES-BJ | Growth inhibition assay | IC50 = 5.256 nM | SANGER | |||
| NCI-H441 | Growth inhibition assay | IC50 = 5.597 nM | SANGER | |||
| KP-4 | Growth inhibition assay | IC50 = 5.611 nM | SANGER | |||
| LoVo | Growth inhibition assay | IC50 = 5.714 nM | SANGER | |||
| HT-1080 | Growth inhibition assay | IC50 = 5.834 nM | SANGER | |||
| GB-1 | Growth inhibition assay | IC50 = 5.845 nM | SANGER | |||
| IA-LM | Growth inhibition assay | IC50 = 5.906 nM | SANGER | |||
| 8-MG-BA | Growth inhibition assay | IC50 = 5.93 nM | SANGER | |||
| SK-HEP-1 | Growth inhibition assay | IC50 = 6.136 nM | SANGER | |||
| 697 | Growth inhibition assay | IC50 = 6.247 nM | SANGER | |||
| KYSE-450 | Growth inhibition assay | IC50 = 6.315 nM | SANGER | |||
| HCC2998 | Growth inhibition assay | IC50 = 6.339 nM | SANGER | |||
| HD-MY-Z | Growth inhibition assay | IC50 = 6.679 nM | SANGER | |||
| OS-RC-2 | Growth inhibition assay | IC50 = 6.681 nM | SANGER | |||
| SF126 | Growth inhibition assay | IC50 = 7.054 nM | SANGER | |||
| Ca-Ski | Growth inhibition assay | IC50 = 7.093 nM | SANGER | |||
| NCI-H358 | Growth inhibition assay | IC50 = 7.16 nM | SANGER | |||
| J82 | Growth inhibition assay | IC50 = 7.41 nM | SANGER | |||
| NCI-H2342 | Growth inhibition assay | IC50 = 7.634 nM | SANGER | |||
| OVCAR-8 | Growth inhibition assay | IC50 = 7.904 nM | SANGER | |||
| TE-8 | Growth inhibition assay | IC50 = 8.001 nM | SANGER | |||
| ETK-1 | Growth inhibition assay | IC50 = 8.076 nM | SANGER | |||
| HAL-01 | Growth inhibition assay | IC50 = 8.195 nM | SANGER | |||
| KYSE-150 | Growth inhibition assay | IC50 = 8.469 nM | SANGER | |||
| NCI-H810 | Growth inhibition assay | IC50 = 8.558 nM | SANGER | |||
| ONS-76 | Growth inhibition assay | IC50 = 8.677 nM | SANGER | |||
| NMC-G1 | Growth inhibition assay | IC50 = 8.762 nM | SANGER | |||
| C3A | Growth inhibition assay | IC50 = 8.839 nM | SANGER | |||
| PA-1 | Growth inhibition assay | IC50 = 8.993 nM | SANGER | |||
| SH-4 | Growth inhibition assay | IC50 = 9.022 nM | SANGER | |||
| EFO-27 | Growth inhibition assay | IC50 = 9.046 nM | SANGER | |||
| CAPAN-1 | Growth inhibition assay | IC50 = 9.227 nM | SANGER | |||
| DU-145 | Growth inhibition assay | IC50 = 9.29 nM | SANGER | |||
| A101D | Growth inhibition assay | IC50 = 9.373 nM | SANGER | |||
| ST486 | Growth inhibition assay | IC50 = 9.406 nM | SANGER | |||
| NCI-H1437 | Growth inhibition assay | IC50 = 9.418 nM | SANGER | |||
| HGC-27 | Growth inhibition assay | IC50 = 9.601 nM | SANGER | |||
| 8305C | Growth inhibition assay | IC50 = 9.64 nM | SANGER | |||
| OCUB-M | Growth inhibition assay | IC50 = 10.03 nM | SANGER | |||
| COLO-679 | Growth inhibition assay | IC50 = 10.07 nM | SANGER | |||
| Detroit562 | Growth inhibition assay | IC50 = 10.42 nM | SANGER | |||
| A204 | Growth inhibition assay | IC50 = 11.16 nM | SANGER | |||
| NCI-H1734 | Growth inhibition assay | IC50 = 11.29 nM | SANGER | |||
| MC-CAR | Growth inhibition assay | IC50 = 11.58 nM | SANGER | |||
| NCI-H2170 | Growth inhibition assay | IC50 = 11.97 nM | SANGER | |||
| NCI-SNU-5 | Growth inhibition assay | IC50 = 12.13 nM | SANGER | |||
| HCE-T | Growth inhibition assay | IC50 = 12.42 nM | SANGER | |||
| KYSE-180 | Growth inhibition assay | IC50 = 12.81 nM | SANGER | |||
| C8166 | Growth inhibition assay | IC50 = 13.08 nM | SANGER | |||
| NCI-H460 | Growth inhibition assay | IC50 = 13.54 nM | SANGER | |||
| SNU-449 | Growth inhibition assay | IC50 = 13.77 nM | SANGER | |||
| MDA-MB-468 | Growth inhibition assay | IC50 = 14.12 nM | SANGER | |||
| COR-L23 | Growth inhibition assay | IC50 = 14.13 nM | SANGER | |||
| CTV-1 | Growth inhibition assay | IC50 = 14.14 nM | SANGER | |||
| BL-41 | Growth inhibition assay | IC50 = 14.37 nM | SANGER | |||
| IGR-1 | Growth inhibition assay | IC50 = 14.42 nM | SANGER | |||
| TK10 | Growth inhibition assay | IC50 = 14.49 nM | SANGER | |||
| REH | Growth inhibition assay | IC50 = 14.51 nM | SANGER | |||
| LU-139 | Growth inhibition assay | IC50 = 14.59 nM | SANGER | |||
| KP-N-YS | Growth inhibition assay | IC50 = 14.97 nM | SANGER | |||
| PANC-10-05 | Growth inhibition assay | IC50 = 15.38 nM | SANGER | |||
| HL-60 | Growth inhibition assay | IC50 = 15.69 nM | SANGER | |||
| T84 | Growth inhibition assay | IC50 = 15.96 nM | SANGER | |||
| RPMI-8226 | Growth inhibition assay | IC50 = 16.02 nM | SANGER | |||
| UM-UC-3 | Growth inhibition assay | IC50 = 16.16 nM | SANGER | |||
| TE-10 | Growth inhibition assay | IC50 = 16.21 nM | SANGER | |||
| CAL-148 | Growth inhibition assay | IC50 = 17.23 nM | SANGER | |||
| BV-173 | Growth inhibition assay | IC50 = 17.27 nM | SANGER | |||
| Calu-3 | Growth inhibition assay | IC50 = 17.29 nM | SANGER | |||
| RPMI-2650 | Growth inhibition assay | IC50 = 17.59 nM | SANGER | |||
| MKN45 | Growth inhibition assay | IC50 = 17.73 nM | SANGER | |||
| NUGC-3 | Growth inhibition assay | IC50 = 18.34 nM | SANGER | |||
| NCI-H520 | Growth inhibition assay | IC50 = 18.77 nM | SANGER | |||
| CCRF-CEM | Growth inhibition assay | IC50 = 18.85 nM | SANGER | |||
| NCI-H2405 | Growth inhibition assay | IC50 = 19.1 nM | SANGER | |||
| ES7 | Growth inhibition assay | IC50 = 19.76 nM | SANGER | |||
| BPH-1 | Growth inhibition assay | IC50 = 20.28 nM | SANGER | |||
| SAS | Growth inhibition assay | IC50 = 20.5 nM | SANGER | |||
| HuCCT1 | Growth inhibition assay | IC50 = 20.58 nM | SANGER | |||
| LOUCY | Growth inhibition assay | IC50 = 20.66 nM | SANGER | |||
| NCI-H292 | Growth inhibition assay | IC50 = 20.79 nM | SANGER | |||
| G-361 | Growth inhibition assay | IC50 = 21.07 nM | SANGER | |||
| M059J | Growth inhibition assay | IC50 = 21.08 nM | SANGER | |||
| NCI-H1651 | Growth inhibition assay | IC50 = 21.11 nM | SANGER | |||
| KALS-1 | Growth inhibition assay | IC50 = 21.39 nM | SANGER | |||
| DJM-1 | Growth inhibition assay | IC50 = 21.59 nM | SANGER | |||
| AU565 | Growth inhibition assay | IC50 = 21.83 nM | SANGER | |||
| HCC38 | Growth inhibition assay | IC50 = 21.95 nM | SANGER | |||
| U251 | Growth inhibition assay | IC50 = 22.27 nM | SANGER | |||
| ABC-1 | Growth inhibition assay | IC50 = 22.65 nM | SANGER | |||
| SK-NEP-1 | Growth inhibition assay | IC50 = 22.93 nM | SANGER | |||
| CESS | Growth inhibition assay | IC50 = 23.19 nM | SANGER | |||
| MIA-PaCa-2 | Growth inhibition assay | IC50 = 23.36 nM | SANGER | |||
| SUP-T1 | Growth inhibition assay | IC50 = 23.47 nM | SANGER | |||
| L-428 | Growth inhibition assay | IC50 = 23.62 nM | SANGER | |||
| SW954 | Growth inhibition assay | IC50 = 23.68 nM | SANGER | |||
| HO-1-N-1 | Growth inhibition assay | IC50 = 23.77 nM | SANGER | |||
| CHP-126 | Growth inhibition assay | IC50 = 24.14 nM | SANGER | |||
| HMV-II | Growth inhibition assay | IC50 = 24.34 nM | SANGER | |||
| NB10 | Growth inhibition assay | IC50 = 24.37 nM | SANGER | |||
| A172 | Growth inhibition assay | IC50 = 24.71 nM | SANGER | |||
| MONO-MAC-6 | Growth inhibition assay | IC50 = 24.84 nM | SANGER | |||
| NCI-H1650 | Growth inhibition assay | IC50 = 25.4 nM | SANGER | |||
| NH-12 | Growth inhibition assay | IC50 = 25.5 nM | SANGER | |||
| ML-2 | Growth inhibition assay | IC50 = 25.74 nM | SANGER | |||
| MZ2-MEL | Growth inhibition assay | IC50 = 26.22 nM | SANGER | |||
| COLO-684 | Growth inhibition assay | IC50 = 26.41 nM | SANGER | |||
| HuP-T4 | Growth inhibition assay | IC50 = 27.3 nM | SANGER | |||
| SW837 | Growth inhibition assay | IC50 = 27.62 nM | SANGER | |||
| MDA-MB-231 | Growth inhibition assay | IC50 = 27.78 nM | SANGER | |||
| KYSE-140 | Growth inhibition assay | IC50 = 27.91 nM | SANGER | |||
| NOMO-1 | Growth inhibition assay | IC50 = 28.68 nM | SANGER | |||
| GP5d | Growth inhibition assay | IC50 = 28.72 nM | SANGER | |||
| COR-L105 | Growth inhibition assay | IC50 = 29.42 nM | SANGER | |||
| LS-411N | Growth inhibition assay | IC50 = 29.88 nM | SANGER | |||
| NY | Growth inhibition assay | IC50 = 30.18 nM | SANGER | |||
| NCI-H2030 | Growth inhibition assay | IC50 = 30.45 nM | SANGER | |||
| CCF-STTG1 | Growth inhibition assay | IC50 = 31.42 nM | SANGER | |||
| NCI-H1703 | Growth inhibition assay | IC50 = 31.78 nM | SANGER | |||
| TUR | Growth inhibition assay | IC50 = 32.03 nM | SANGER | |||
| NOS-1 | Growth inhibition assay | IC50 = 32.44 nM | SANGER | |||
| A2058 | Growth inhibition assay | IC50 = 32.83 nM | SANGER | |||
| LCLC-103H | Growth inhibition assay | IC50 = 33.25 nM | SANGER | |||
| NCI-H510A | Growth inhibition assay | IC50 = 33.27 nM | SANGER | |||
| BC-1 | Growth inhibition assay | IC50 = 33.77 nM | SANGER | |||
| SK-CO-1 | Growth inhibition assay | IC50 = 34.01 nM | SANGER | |||
| A673 | Growth inhibition assay | IC50 = 34.17 nM | SANGER | |||
| VM-CUB-1 | Growth inhibition assay | IC50 = 34.69 nM | SANGER | |||
| HH | Growth inhibition assay | IC50 = 35.06 nM | SANGER | |||
| CAL-27 | Growth inhibition assay | IC50 = 35.16 nM | SANGER | |||
| NEC8 | Growth inhibition assay | IC50 = 35.37 nM | SANGER | |||
| BxPC-3 | Growth inhibition assay | IC50 = 36.91 nM | SANGER | |||
| SNB75 | Growth inhibition assay | IC50 = 37.24 nM | SANGER | |||
| NB13 | Growth inhibition assay | IC50 = 38.23 nM | SANGER | |||
| SK-OV-3 | Growth inhibition assay | IC50 = 38.74 nM | SANGER | |||
| ME-180 | Growth inhibition assay | IC50 = 38.8 nM | SANGER | |||
| JiyoyeP-2003 | Growth inhibition assay | IC50 = 39.38 nM | SANGER | |||
| LU-134-A | Growth inhibition assay | IC50 = 40.02 nM | SANGER | |||
| LS-123 | Growth inhibition assay | IC50 = 40.28 nM | SANGER | |||
| COLO-800 | Growth inhibition assay | IC50 = 40.56 nM | SANGER | |||
| LB831-BLC | Growth inhibition assay | IC50 = 41.85 nM | SANGER | |||
| NCI-H747 | Growth inhibition assay | IC50 = 42.28 nM | SANGER | |||
| MZ7-mel | Growth inhibition assay | IC50 = 42.66 nM | SANGER | |||
| GT3TKB | Growth inhibition assay | IC50 = 42.72 nM | SANGER | |||
| 23132-87 | Growth inhibition assay | IC50 = 43.05 nM | SANGER | |||
| MOLT-16 | Growth inhibition assay | IC50 = 43.05 nM | SANGER | |||
| PF-382 | Growth inhibition assay | IC50 = 44.22 nM | SANGER | |||
| ES3 | Growth inhibition assay | IC50 = 44.6 nM | SANGER | |||
| SW756 | Growth inhibition assay | IC50 = 45.14 nM | SANGER | |||
| OAW-28 | Growth inhibition assay | IC50 = 45.36 nM | SANGER | |||
| RPMI-8402 | Growth inhibition assay | IC50 = 45.93 nM | SANGER | |||
| NCI-H1693 | Growth inhibition assay | IC50 = 46.09 nM | SANGER | |||
| MS-1 | Growth inhibition assay | IC50 = 46.34 nM | SANGER | |||
| WSU-NHL | Growth inhibition assay | IC50 = 50.35 nM | SANGER | |||
| HCT-116 | Growth inhibition assay | IC50 = 50.83 nM | SANGER | |||
| SF295 | Growth inhibition assay | IC50 = 51.12 nM | SANGER | |||
| MFE-296 | Growth inhibition assay | IC50 = 51.35 nM | SANGER | |||
| NCI-H209 | Growth inhibition assay | IC50 = 52.07 nM | SANGER | |||
| SW962 | Growth inhibition assay | IC50 = 52.41 nM | SANGER | |||
| CTB-1 | Growth inhibition assay | IC50 = 53.39 nM | SANGER | |||
| EFO-21 | Growth inhibition assay | IC50 = 53.66 nM | SANGER | |||
| A704 | Growth inhibition assay | IC50 = 53.78 nM | SANGER | |||
| COR-L279 | Growth inhibition assay | IC50 = 53.91 nM | SANGER | |||
| HN | Growth inhibition assay | IC50 = 54.09 nM | SANGER | |||
| Caov-3 | Growth inhibition assay | IC50 = 54.13 nM | SANGER | |||
| NCI-H1770 | Growth inhibition assay | IC50 = 55.04 nM | SANGER | |||
| G-401 | Growth inhibition assay | IC50 = 55.16 nM | SANGER | |||
| KYSE-410 | Growth inhibition assay | IC50 = 55.87 nM | SANGER | |||
| OE33 | Growth inhibition assay | IC50 = 61.17 nM | SANGER | |||
| NCI-H1694 | Growth inhibition assay | IC50 = 61.29 nM | SANGER | |||
| KG-1 | Growth inhibition assay | IC50 = 62.2 nM | SANGER | |||
| SNU-423 | Growth inhibition assay | IC50 = 62.48 nM | SANGER | |||
| GDM-1 | Growth inhibition assay | IC50 = 62.54 nM | SANGER | |||
| SU-DHL-1 | Growth inhibition assay | IC50 = 62.66 nM | SANGER | |||
| LB2518-MEL | Growth inhibition assay | IC50 = 64.52 nM | SANGER | |||
| LB996-RCC | Growth inhibition assay | IC50 = 65.09 nM | SANGER | |||
| MOLT-4 | Growth inhibition assay | IC50 = 65.28 nM | SANGER | |||
| J-RT3-T3-5 | Growth inhibition assay | IC50 = 67.18 nM | SANGER | |||
| HCC1599 | Growth inhibition assay | IC50 = 70.22 nM | SANGER | |||
| TYK-nu | Growth inhibition assay | IC50 = 72.64 nM | SANGER | |||
| EW-18 | Growth inhibition assay | IC50 = 72.75 nM | SANGER | |||
| LC4-1 | Growth inhibition assay | IC50 = 74.74 nM | SANGER | |||
| COLO-680N | Growth inhibition assay | IC50 = 75.49 nM | SANGER | |||
| MKN1 | Growth inhibition assay | IC50 = 78.37 nM | SANGER | |||
| HCT-15 | Growth inhibition assay | IC50 = 82.16 nM | SANGER | |||
| NCI-H1882 | Growth inhibition assay | IC50 = 82.45 nM | SANGER | |||
| IMR-5 | Growth inhibition assay | IC50 = 82.96 nM | SANGER | |||
| DB | Growth inhibition assay | IC50 = 84.4 nM | SANGER | |||
| P12-ICHIKAWA | Growth inhibition assay | IC50 = 84.7 nM | SANGER | |||
| KARPAS-422 | Growth inhibition assay | IC50 = 85.79 nM | SANGER | |||
| SK-N-DZ | Growth inhibition assay | IC50 = 86.56 nM | SANGER | |||
| FTC-133 | Growth inhibition assay | IC50 = 87.49 nM | SANGER | |||
| SCC-3 | Growth inhibition assay | IC50 = 89.64 nM | SANGER | |||
| KM12 | Growth inhibition assay | IC50 = 91.49 nM | SANGER | |||
| OAW-42 | Growth inhibition assay | IC50 = 92.14 nM | SANGER | |||
| GCIY | Growth inhibition assay | IC50 = 92.69 nM | SANGER | |||
| KYSE-520 | Growth inhibition assay | IC50 = 92.84 nM | SANGER | |||
| RPMI-8866 | Growth inhibition assay | IC50 = 95.23 nM | SANGER | |||
| L-363 | Growth inhibition assay | IC50 = 95.5 nM | SANGER | |||
| 22RV1 | Growth inhibition assay | IC50 = 96.48 nM | SANGER | |||
| DSH1 | Growth inhibition assay | IC50 = 96.5 nM | SANGER | |||
| A253 | Growth inhibition assay | IC50 = 102.28 nM | SANGER | |||
| NCI-H661 | Growth inhibition assay | IC50 = 104.02 nM | SANGER | |||
| SK-MEL-3 | Growth inhibition assay | IC50 = 105.1 nM | SANGER | |||
| FADU | Growth inhibition assay | IC50 = 105.45 nM | SANGER | |||
| SJRH30 | Growth inhibition assay | IC50 = 106.41 nM | SANGER | |||
| HCC1569 | Growth inhibition assay | IC50 = 109.36 nM | SANGER | |||
| NCI-H526 | Growth inhibition assay | IC50 = 109.88 nM | SANGER | |||
| BL-70 | Growth inhibition assay | IC50 = 110.97 nM | SANGER | |||
| SW1990 | Growth inhibition assay | IC50 = 113.07 nM | SANGER | |||
| LAMA-84 | Growth inhibition assay | IC50 = 115.04 nM | SANGER | |||
| COLO-741 | Growth inhibition assay | IC50 = 120.12 nM | SANGER | |||
| SCC-15 | Growth inhibition assay | IC50 = 121.13 nM | SANGER | |||
| DBTRG-05MG | Growth inhibition assay | IC50 = 121.82 nM | SANGER | |||
| HEC-1 | Growth inhibition assay | IC50 = 123.63 nM | SANGER | |||
| D-283MED | Growth inhibition assay | IC50 = 126.98 nM | SANGER | |||
| RD | Growth inhibition assay | IC50 = 130.11 nM | SANGER | |||
| K052 | Growth inhibition assay | IC50 = 136.71 nM | SANGER | |||
| CAL-85-1 | Growth inhibition assay | IC50 = 144.63 nM | SANGER | |||
| NCI-H2052 | Growth inhibition assay | IC50 = 144.82 nM | SANGER | |||
| BFTC-909 | Growth inhibition assay | IC50 = 145.6 nM | SANGER | |||
| HuP-T3 | Growth inhibition assay | IC50 = 145.65 nM | SANGER | |||
| NCI-H64 | Growth inhibition assay | IC50 = 150.93 nM | SANGER | |||
| C-4-II | Growth inhibition assay | IC50 = 152.37 nM | SANGER | |||
| KMOE-2 | Growth inhibition assay | IC50 = 154.93 nM | SANGER | |||
| NB12 | Growth inhibition assay | IC50 = 155.15 nM | SANGER | |||
| EM-2 | Growth inhibition assay | IC50 = 159.9 nM | SANGER | |||
| SIMA | Growth inhibition assay | IC50 = 161.25 nM | SANGER | |||
| SBC-1 | Growth inhibition assay | IC50 = 165.57 nM | SANGER | |||
| KS-1 | Growth inhibition assay | IC50 = 166.52 nM | SANGER | |||
| no-10 | Growth inhibition assay | IC50 = 173.76 nM | SANGER | |||
| NCCIT | Growth inhibition assay | IC50 = 176.26 nM | SANGER | |||
| RERF-LC-MS | Growth inhibition assay | IC50 = 176.69 nM | SANGER | |||
| BT-20 | Growth inhibition assay | IC50 = 181.74 nM | SANGER | |||
| NCI-H1623 | Growth inhibition assay | IC50 = 187.08 nM | SANGER | |||
| TE-9 | Growth inhibition assay | IC50 = 189.63 nM | SANGER | |||
| U-87-MG | Growth inhibition assay | IC50 = 190.57 nM | SANGER | |||
| CAL-51 | Growth inhibition assay | IC50 = 191.14 nM | SANGER | |||
| 639-V | Growth inhibition assay | IC50 = 193.14 nM | SANGER | |||
| SJSA-1 | Growth inhibition assay | IC50 = 195.01 nM | SANGER | |||
| DOHH-2 | Growth inhibition assay | IC50 = 195.64 nM | SANGER | |||
| IST-SL1 | Growth inhibition assay | IC50 = 197.47 nM | SANGER | |||
| NCI-H1618 | Growth inhibition assay | IC50 = 197.56 nM | SANGER | |||
| TGW | Growth inhibition assay | IC50 = 199.64 nM | SANGER | |||
| HT-3 | Growth inhibition assay | IC50 = 0.20054 μM | SANGER | |||
| AN3-CA | Growth inhibition assay | IC50 = 0.20329 μM | SANGER | |||
| PC-14 | Growth inhibition assay | IC50 = 0.20331 μM | SANGER | |||
| BHT-101 | Growth inhibition assay | IC50 = 0.21039 μM | SANGER | |||
| NCI-H23 | Growth inhibition assay | IC50 = 0.21106 μM | SANGER | |||
| SCC-4 | Growth inhibition assay | IC50 = 0.21185 μM | SANGER | |||
| EGI-1 | Growth inhibition assay | IC50 = 0.21386 μM | SANGER | |||
| Calu-1 | Growth inhibition assay | IC50 = 0.22003 μM | SANGER | |||
| BC-3 | Growth inhibition assay | IC50 = 0.22065 μM | SANGER | |||
| HOP-62 | Growth inhibition assay | IC50 = 0.22258 μM | SANGER | |||
| NCI-H1793 | Growth inhibition assay | IC50 = 0.22363 μM | SANGER | |||
| COLO-320-HSR | Growth inhibition assay | IC50 = 0.22408 μM | SANGER | |||
| NCI-H596 | Growth inhibition assay | IC50 = 0.22513 μM | SANGER | |||
| EHEB | Growth inhibition assay | IC50 = 0.22651 μM | SANGER | |||
| BEN | Growth inhibition assay | IC50 = 0.23791 μM | SANGER | |||
| MHH-PREB-1 | Growth inhibition assay | IC50 = 0.24804 μM | SANGER | |||
| TE-6 | Growth inhibition assay | IC50 = 0.25035 μM | SANGER | |||
| KARPAS-299 | Growth inhibition assay | IC50 = 0.252 μM | SANGER | |||
| BOKU | Growth inhibition assay | IC50 = 0.25433 μM | SANGER | |||
| MZ1-PC | Growth inhibition assay | IC50 = 0.25435 μM | SANGER | |||
| IPC-298 | Growth inhibition assay | IC50 = 0.25477 μM | SANGER | |||
| NCI-H1792 | Growth inhibition assay | IC50 = 0.25904 μM | SANGER | |||
| KM-H2 | Growth inhibition assay | IC50 = 0.26068 μM | SANGER | |||
| Becker | Growth inhibition assay | IC50 = 0.26704 μM | SANGER | |||
| NCI-H446 | Growth inhibition assay | IC50 = 0.26911 μM | SANGER | |||
| MLMA | Growth inhibition assay | IC50 = 0.27156 μM | SANGER | |||
| JEG-3 | Growth inhibition assay | IC50 = 0.27669 μM | SANGER | |||
| SCC-25 | Growth inhibition assay | IC50 = 0.28928 μM | SANGER | |||
| CA46 | Growth inhibition assay | IC50 = 0.29339 μM | SANGER | |||
| CAL-54 | Growth inhibition assay | IC50 = 0.29759 μM | SANGER | |||
| KYSE-70 | Growth inhibition assay | IC50 = 0.29969 μM | SANGER | |||
| LU-65 | Growth inhibition assay | IC50 = 0.30381 μM | SANGER | |||
| OVCAR-5 | Growth inhibition assay | IC50 = 0.30577 μM | SANGER | |||
| NCI-H2081 | Growth inhibition assay | IC50 = 0.31077 μM | SANGER | |||
| NCI-H226 | Growth inhibition assay | IC50 = 0.31696 μM | SANGER | |||
| A427 | Growth inhibition assay | IC50 = 0.32398 μM | SANGER | |||
| CPC-N | Growth inhibition assay | IC50 = 0.329 μM | SANGER | |||
| SW13 | Growth inhibition assay | IC50 = 0.33037 μM | SANGER | |||
| K-562 | Growth inhibition assay | IC50 = 0.33298 μM | SANGER | |||
| NCI-N87 | Growth inhibition assay | IC50 = 0.33304 μM | SANGER | |||
| U-698-M | Growth inhibition assay | IC50 = 0.34453 μM | SANGER | |||
| IM-9 | Growth inhibition assay | IC50 = 0.34691 μM | SANGER | |||
| NCI-H748 | Growth inhibition assay | IC50 = 0.35458 μM | SANGER | |||
| UACC-257 | Growth inhibition assay | IC50 = 0.36412 μM | SANGER | |||
| HT-1376 | Growth inhibition assay | IC50 = 0.36895 μM | SANGER | |||
| GAK | Growth inhibition assay | IC50 = 0.37294 μM | SANGER | |||
| NCI-H82 | Growth inhibition assay | IC50 = 0.37297 μM | SANGER | |||
| NCI-H1304 | Growth inhibition assay | IC50 = 0.38454 μM | SANGER | |||
| MHH-NB-11 | Growth inhibition assay | IC50 = 0.38597 μM | SANGER | |||
| CAMA-1 | Growth inhibition assay | IC50 = 0.3958 μM | SANGER | |||
| GCT | Growth inhibition assay | IC50 = 0.4051 μM | SANGER | |||
| HPAF-II | Growth inhibition assay | IC50 = 0.42847 μM | SANGER | |||
| Raji | Growth inhibition assay | IC50 = 0.43145 μM | SANGER | |||
| EW-11 | Growth inhibition assay | IC50 = 0.43352 μM | SANGER | |||
| SW1573 | Growth inhibition assay | IC50 = 0.45733 μM | SANGER | |||
| KLE | Growth inhibition assay | IC50 = 0.45942 μM | SANGER | |||
| NCI-H69 | Growth inhibition assay | IC50 = 0.45948 μM | SANGER | |||
| MDA-MB-361 | Growth inhibition assay | IC50 = 0.46064 μM | SANGER | |||
| SW48 | Growth inhibition assay | IC50 = 0.46259 μM | SANGER | |||
| SK-MM-2 | Growth inhibition assay | IC50 = 0.47912 μM | SANGER | |||
| MC116 | Growth inhibition assay | IC50 = 0.48166 μM | SANGER | |||
| NB1 | Growth inhibition assay | IC50 = 0.48753 μM | SANGER | |||
| NCI-H1155 | Growth inhibition assay | IC50 = 0.48828 μM | SANGER | |||
| SN12C | Growth inhibition assay | IC50 = 0.49734 μM | SANGER | |||
| NCI-H838 | Growth inhibition assay | IC50 = 0.49875 μM | SANGER | |||
| SW1463 | Growth inhibition assay | IC50 = 0.51017 μM | SANGER | |||
| NCI-H1648 | Growth inhibition assay | IC50 = 0.51081 μM | SANGER | |||
| M14 | Growth inhibition assay | IC50 = 0.51466 μM | SANGER | |||
| T98G | Growth inhibition assay | IC50 = 0.53948 μM | SANGER | |||
| CaR-1 | Growth inhibition assay | IC50 = 0.55122 μM | SANGER | |||
| NCI-H650 | Growth inhibition assay | IC50 = 0.56569 μM | SANGER | |||
| HuH-7 | Growth inhibition assay | IC50 = 0.56861 μM | SANGER | |||
| Daudi | Growth inhibition assay | IC50 = 0.56949 μM | SANGER | |||
| CAL-120 | Growth inhibition assay | IC50 = 0.57588 μM | SANGER | |||
| EW-3 | Growth inhibition assay | IC50 = 0.57956 μM | SANGER | |||
| OMC-1 | Growth inhibition assay | IC50 = 0.58333 μM | SANGER | |||
| U-266 | Growth inhibition assay | IC50 = 0.60794 μM | SANGER | |||
| OVCAR-4 | Growth inhibition assay | IC50 = 0.62523 μM | SANGER | |||
| RCC10RGB | Growth inhibition assay | IC50 = 0.63374 μM | SANGER | |||
| NCI-H2141 | Growth inhibition assay | IC50 = 0.64404 μM | SANGER | |||
| Ramos-2G6-4C10 | Growth inhibition assay | IC50 = 0.66087 μM | SANGER | |||
| THP-1 | Growth inhibition assay | IC50 = 0.6642 μM | SANGER | |||
| RCM-1 | Growth inhibition assay | IC50 = 0.66478 μM | SANGER | |||
| K5 | Growth inhibition assay | IC50 = 0.68269 μM | SANGER | |||
| MPP-89 | Growth inhibition assay | IC50 = 0.69228 μM | SANGER | |||
| ChaGo-K-1 | Growth inhibition assay | IC50 = 0.6956 μM | SANGER | |||
| OE19 | Growth inhibition assay | IC50 = 0.70216 μM | SANGER | |||
| NCI-H1755 | Growth inhibition assay | IC50 = 0.71816 μM | SANGER | |||
| KNS-42 | Growth inhibition assay | IC50 = 0.73582 μM | SANGER | |||
| no-11 | Growth inhibition assay | IC50 = 0.73668 μM | SANGER | |||
| IST-MES1 | Growth inhibition assay | IC50 = 0.77354 μM | SANGER | |||
| NCI-H2347 | Growth inhibition assay | IC50 = 0.79201 μM | SANGER | |||
| SKG-IIIa | Growth inhibition assay | IC50 = 0.80972 μM | SANGER | |||
| UACC-62 | Growth inhibition assay | IC50 = 0.8126 μM | SANGER | |||
| SNU-387 | Growth inhibition assay | IC50 = 0.82744 μM | SANGER | |||
| LS-513 | Growth inhibition assay | IC50 = 0.88761 μM | SANGER | |||
| NCI-H719 | Growth inhibition assay | IC50 = 0.89157 μM | SANGER | |||
| HOP-92 | Growth inhibition assay | IC50 = 0.95075 μM | SANGER | |||
| CAS-1 | Growth inhibition assay | IC50 = 0.95508 μM | SANGER | |||
| HTC-C3 | Growth inhibition assay | IC50 = 0.9965 μM | SANGER | |||
| D-392MG | Growth inhibition assay | IC50 = 1.02288 μM | SANGER | |||
| MHH-CALL-2 | Growth inhibition assay | IC50 = 1.02319 μM | SANGER | |||
| DMS-53 | Growth inhibition assay | IC50 = 1.03815 μM | SANGER | |||
| TGBC24TKB | Growth inhibition assay | IC50 = 1.04183 μM | SANGER | |||
| NCI-H1417 | Growth inhibition assay | IC50 = 1.07075 μM | SANGER | |||
| OVCAR-3 | Growth inhibition assay | IC50 = 1.0739 μM | SANGER | |||
| RXF393 | Growth inhibition assay | IC50 = 1.1432 μM | SANGER | |||
| MKN28 | Growth inhibition assay | IC50 = 1.15124 μM | SANGER | |||
| MSTO-211H | Growth inhibition assay | IC50 = 1.15257 μM | SANGER | |||
| NCI-H2126 | Growth inhibition assay | IC50 = 1.15799 μM | SANGER | |||
| TCCSUP | Growth inhibition assay | IC50 = 1.16785 μM | SANGER | |||
| TE-12 | Growth inhibition assay | IC50 = 1.17366 μM | SANGER | |||
| NCI-H1581 | Growth inhibition assay | IC50 = 1.17372 μM | SANGER | |||
| GOTO | Growth inhibition assay | IC50 = 1.20277 μM | SANGER | |||
| NCI-H28 | Growth inhibition assay | IC50 = 1.2149 μM | SANGER | |||
| KNS-81-FD | Growth inhibition assay | IC50 = 1.23463 μM | SANGER | |||
| YT | Growth inhibition assay | IC50 = 1.28559 μM | SANGER | |||
| NB5 | Growth inhibition assay | IC50 = 1.32585 μM | SANGER | |||
| U-118-MG | Growth inhibition assay | IC50 = 1.35159 μM | SANGER | |||
| LS-1034 | Growth inhibition assay | IC50 = 1.3845 μM | SANGER | |||
| PANC-08-13 | Growth inhibition assay | IC50 = 1.39613 μM | SANGER | |||
| COLO-205 | Growth inhibition assay | IC50 = 1.47181 μM | SANGER | |||
| KURAMOCHI | Growth inhibition assay | IC50 = 1.49739 μM | SANGER | |||
| SNU-C2B | Growth inhibition assay | IC50 = 1.54777 μM | SANGER | |||
| HDLM-2 | Growth inhibition assay | IC50 = 1.63327 μM | SANGER | |||
| PFSK-1 | Growth inhibition assay | IC50 = 1.64794 μM | SANGER | |||
| SW1088 | Growth inhibition assay | IC50 = 1.66167 μM | SANGER | |||
| LB373-MEL-D | Growth inhibition assay | IC50 = 1.66495 μM | SANGER | |||
| HT-1197 | Growth inhibition assay | IC50 = 1.76425 μM | SANGER | |||
| MMAC-SF | Growth inhibition assay | IC50 = 1.7766 μM | SANGER | |||
| T-24 | Growth inhibition assay | IC50 = 2.07629 μM | SANGER | |||
| LK-2 | Growth inhibition assay | IC50 = 2.08563 μM | SANGER | |||
| 5637 | Growth inhibition assay | IC50 = 2.10298 μM | SANGER | |||
| GI-ME-N | Growth inhibition assay | IC50 = 2.10851 μM | SANGER | |||
| NCI-H2196 | Growth inhibition assay | IC50 = 2.31034 μM | SANGER | |||
| KOSC-2 | Growth inhibition assay | IC50 = 2.35338 μM | SANGER | |||
| MN-60 | Growth inhibition assay | IC50 = 2.43457 μM | SANGER | |||
| AsPC-1 | Growth inhibition assay | IC50 = 2.50301 μM | SANGER | |||
| MDA-MB-175-VII | Growth inhibition assay | IC50 = 2.51493 μM | SANGER | |||
| DG-75 | Growth inhibition assay | IC50 = 2.5612 μM | SANGER | |||
| LNCaP-Clone-FGC | Growth inhibition assay | IC50 = 2.65415 μM | SANGER | |||
| SCLC-21H | Growth inhibition assay | IC50 = 2.77414 μM | SANGER | |||
| EFE-184 | Growth inhibition assay | IC50 = 2.79042 μM | SANGER | |||
| HCC2157 | Growth inhibition assay | IC50 = 2.80678 μM | SANGER | |||
| NCI-H1573 | Growth inhibition assay | IC50 = 2.80723 μM | SANGER | |||
| PC-3 | Growth inhibition assay | IC50 = 2.83163 μM | SANGER | |||
| KY821 | Growth inhibition assay | IC50 = 2.8814 μM | SANGER | |||
| ECC4 | Growth inhibition assay | IC50 = 2.92765 μM | SANGER | |||
| SK-N-AS | Growth inhibition assay | IC50 = 2.96758 μM | SANGER | |||
| NB6 | Growth inhibition assay | IC50 = 3.2819 μM | SANGER | |||
| KMS-12-PE | Growth inhibition assay | IC50 = 3.55998 μM | SANGER | |||
| NCI-H2171 | Growth inhibition assay | IC50 = 3.76535 μM | SANGER | |||
| TE-11 | Growth inhibition assay | IC50 = 4.09997 μM | SANGER | |||
| DMS-153 | Growth inhibition assay | IC50 = 4.10246 μM | SANGER | |||
| RVH-421 | Growth inhibition assay | IC50 = 4.11559 μM | SANGER | |||
| RO82-W-1 | Growth inhibition assay | IC50 = 4.42356 μM | SANGER | |||
| TE-1 | Growth inhibition assay | IC50 = 5.86741 μM | SANGER | |||
| MFE-280 | Growth inhibition assay | IC50 = 5.90388 μM | SANGER | |||
| HT | Growth inhibition assay | IC50 = 5.93153 μM | SANGER | |||
| NCI-H1963 | Growth inhibition assay | IC50 = 6.26713 μM | SANGER | |||
| S-117 | Growth inhibition assay | IC50 = 6.30327 μM | SANGER | |||
| TGBC1TKB | Growth inhibition assay | IC50 = 6.51712 μM | SANGER | |||
| NCI-H1522 | Growth inhibition assay | IC50 = 6.53336 μM | SANGER | |||
| TE-441-T | Growth inhibition assay | IC50 = 6.5501 μM | SANGER | |||
| UACC-893 | Growth inhibition assay | IC50 = 6.55203 μM | SANGER | |||
| SHP-77 | Growth inhibition assay | IC50 = 6.85463 μM | SANGER | |||
| TALL-1 | Growth inhibition assay | IC50 = 7.00001 μM | SANGER | |||
| T47D | Growth inhibition assay | IC50 = 7.00094 μM | SANGER | |||
| Capan-2 | Growth inhibition assay | IC50 = 7.09987 μM | SANGER | |||
| SK-MEL-2 | Growth inhibition assay | IC50 = 7.13094 μM | SANGER | |||
| NCI-H1092 | Growth inhibition assay | IC50 = 7.15535 μM | SANGER | |||
| LP-1 | Growth inhibition assay | IC50 = 7.30969 μM | SANGER | |||
| NCI-H889 | Growth inhibition assay | IC50 = 7.57024 μM | SANGER | |||
| NCI-H2452 | Growth inhibition assay | IC50 = 7.63456 μM | SANGER | |||
| UMC-11 | Growth inhibition assay | IC50 = 8.35939 μM | SANGER | |||
| LU-165 | Growth inhibition assay | IC50 = 8.41085 μM | SANGER | |||
| Mewo | Growth inhibition assay | IC50 = 8.43715 μM | SANGER | |||
| C32 | Growth inhibition assay | IC50 = 8.43927 μM | SANGER | |||
| DV-90 | Growth inhibition assay | IC50 = 8.45559 μM | SANGER | |||
| SW1417 | Growth inhibition assay | IC50 = 8.63434 μM | SANGER | |||
| NCI-H187 | Growth inhibition assay | IC50 = 8.85234 μM | SANGER | |||
| LU-99A | Growth inhibition assay | IC50 = 9.13742 μM | SANGER | |||
| DMS-79 | Growth inhibition assay | IC50 = 9.4013 μM | SANGER | |||
| MDA-MB-415 | Growth inhibition assay | IC50 = 9.95336 μM | SANGER | |||
| HCC1954 | Growth inhibition assay | IC50 = 9.97404 μM | SANGER | |||
| EB-3 | Growth inhibition assay | IC50 = 11.1641 μM | SANGER | |||
| CW-2 | Growth inhibition assay | IC50 = 11.2237 μM | SANGER | |||
| COR-L88 | Growth inhibition assay | IC50 = 11.4887 μM | SANGER | |||
| CP50-MEL-B | Growth inhibition assay | IC50 = 11.567 μM | SANGER | |||
| LN-405 | Growth inhibition assay | IC50 = 11.8448 μM | SANGER | |||
| EVSA-T | Growth inhibition assay | IC50 = 11.9609 μM | SANGER | |||
| HCC70 | Growth inhibition assay | IC50 = 12.0511 μM | SANGER | |||
| UACC-812 | Growth inhibition assay | IC50 = 13.3687 μM | SANGER | |||
| LC-1F | Growth inhibition assay | IC50 = 13.4575 μM | SANGER | |||
| HCC1419 | Growth inhibition assay | IC50 = 13.5715 μM | SANGER | |||
| C2BBe1 | Growth inhibition assay | IC50 = 13.6612 μM | SANGER | |||
| COLO-678 | Growth inhibition assay | IC50 = 13.7484 μM | SANGER | |||
| RT4 | Growth inhibition assay | IC50 = 13.8428 μM | SANGER | |||
| NCI-H524 | Growth inhibition assay | IC50 = 15.3769 μM | SANGER | |||
| HCC1143 | Growth inhibition assay | IC50 = 16.3541 μM | SANGER | |||
| HT55 | Growth inhibition assay | IC50 = 16.4103 μM | SANGER | |||
| CAL-39 | Growth inhibition assay | IC50 = 16.6227 μM | SANGER | |||
| KU-19-19 | Growth inhibition assay | IC50 = 16.8123 μM | SANGER | |||
| LB771-HNC | Growth inhibition assay | IC50 = 16.9876 μM | SANGER | |||
| OPM-2 | Growth inhibition assay | IC50 = 17.6337 μM | SANGER | |||
| CAKI-1 | Growth inhibition assay | IC50 = 18.0406 μM | SANGER | |||
| KP-N-YN | Growth inhibition assay | IC50 = 18.8885 μM | SANGER | |||
| SW948 | Growth inhibition assay | IC50 = 20.4975 μM | SANGER | |||
| SK-MEL-1 | Growth inhibition assay | IC50 = 20.6083 μM | SANGER | |||
| NCI-H1563 | Growth inhibition assay | IC50 = 21.5347 μM | SANGER | |||
| GMS-10 | Growth inhibition assay | IC50 = 21.6061 μM | SANGER | |||
| MDA-MB-453 | Growth inhibition assay | IC50 = 22.2184 μM | SANGER | |||
| PLC-PRF-5 | Growth inhibition assay | IC50 = 22.8813 μM | SANGER | |||
| EFM-19 | Growth inhibition assay | IC50 = 24.2029 μM | SANGER | |||
| SK-N-FI | Growth inhibition assay | IC50 = 25.1429 μM | SANGER | |||
| Saos-2 | Growth inhibition assay | IC50 = 26.765 μM | SANGER | |||
| KARPAS-45 | Growth inhibition assay | IC50 = 27.5648 μM | SANGER | |||
| EKVX | Growth inhibition assay | IC50 = 27.7875 μM | SANGER | |||
| KINGS-1 | Growth inhibition assay | IC50 = 30.879 μM | SANGER | |||
| NCI-H2227 | Growth inhibition assay | IC50 = 31.2813 μM | SANGER | |||
| D-542MG | Growth inhibition assay | IC50 = 32.2968 μM | SANGER | |||
| D-263MG | Growth inhibition assay | IC50 = 33.5726 μM | SANGER | |||
| A498 | Growth inhibition assay | IC50 = 38.4491 μM | SANGER | |||
| MDA-MB-157 | Growth inhibition assay | IC50 = 38.5533 μM | SANGER | |||
| RMG-I | Growth inhibition assay | IC50 = 42.9009 μM | SANGER | |||
| COLO-792 | Growth inhibition assay | IC50 = 43.2931 μM | SANGER | |||
| SK-MEL-24 | Growth inhibition assay | IC50 = 43.4294 μM | SANGER | |||
| SNU-475 | Growth inhibition assay | IC50 = 44.5002 μM | SANGER | |||
| HuO-3N1 | Growth inhibition assay | IC50 = 46.3321 μM | SANGER | |||
| LAN-6 | Growth inhibition assay | IC50 = 46.6441 μM | SANGER | |||
| NCI-H720 | Growth inhibition assay | IC50 = 46.7503 μM | SANGER | |||
| BB49-HNC | Growth inhibition assay | IC50 = 47.6209 μM | SANGER | |||
| TT | Growth inhibition assay | IC50 = 49.8459 μM | SANGER | |||
| Ramos | Cytotoxicity assay | 72 hrs | EC50 = 0.00003 μM | 27032331 | ||
| MDA-MB-231 | Antiproliferative assay | GI50 = 0.000251 μM | 29301085 | |||
| Colo-357 | Cytotoxicity assay | IC50 = 0.00036 μM | 20930123 | |||
| SW620 | Antiproliferative assay | GI50 = 0.00084 μM | 29301085 | |||
| BV173 | Cytotoxicity assay | 3 days | IC50 = 0.001 μM | 21711054 | ||
| PANC1 | Cytotoxicity assay | IC50 = 0.001 μM | 20930123 | |||
| RT112 | Cytotoxicity assay | EC50 = 0.0014 μM | 24471998 | |||
| A2780 | Growth inhibition assay | IC50 = 0.0015 μM | 17602464 | |||
| T3M4 | Cytotoxicity assay | IC50 = 0.0015 μM | 20930123 | |||
| NCI-H23 | Cytotoxicity assay | 5 days | GI50 = 0.002 μM | 19929004 | ||
| H460 | Antiproliferative assay | GI50 = 0.002085 μM | 29301085 | |||
| OVCAR8 | Antiproliferative assay | 72 hrs | IC50 = 0.0026 μM | 18469809 | ||
| PC3 | Antiproliferative assay | 72 hrs | IC50 = 0.0026 μM | 18469809 | ||
| A2780/E6 | Antiproliferative assay | 72 hrs | IC50 = 0.0026 μM | 18469809 | ||
| Patu-T | Cytotoxicity assay | IC50 = 0.0028 μM | 20930123 | |||
| HCT15 | Cytotoxicity assay | 5 days | GI50 = 0.003 μM | 19929004 | ||
| HT-29 | Cytotoxicity assay | IC50 = 0.003 μM | 11728191 | |||
| OVCAR8 | Antiproliferative assay | 72 hrs | IC50 = 0.003 μM | 20873740 | ||
| C3 | Antiproliferative assay | 72 hrs | IC50 = 0.003 μM | 20873740 | ||
| Patu-S | Cytotoxicity assay | IC50 = 0.0032 μM | 20930123 | |||
| Patu-02 | Cytotoxicity assay | IC50 = 0.0034 μM | 20930123 | |||
| DAN-G | Cytotoxicity assay | IC50 = 0.0034 μM | 20930123 | |||
| DU145 | Antiproliferative assay | IC50 = 0.0035 μM | 17887663 | |||
| BxPC3 | Growth inhibition assay | 48 hrs | GI50 = 0.00364 μM | 23094992 | ||
| A549 | Cytotoxicity assay | 24 hrs | IC50 = 0.0039 μM | 25874330 | ||
| A549 | Cytotoxicity assay | 48 hrs | IC50 = 0.0039 μM | 25874330 | ||
| MRC5 | Cytotoxicity assay | 48 hrs | IC50 = 0.0039 μM | 25874330 | ||
| T24 | Cytotoxicity assay | 48 hrs | IC50 = 0.0039 μM | 25874330 | ||
| T24 | Cytotoxicity assay | 24 hrs | IC50 = 0.0039 μM | 25874330 | ||
| MRC5 | Cytotoxicity assay | 24 hrs | IC50 = 0.0039 μM | 25874330 | ||
| BT549 | Cytotoxicity assay | 5 days | GI50 = 0.004 μM | 19929004 | ||
| MCF7 | Cytotoxicity assay | 24 hrs | LD50 = 0.004 μM | 24786915 | ||
| Aspc-1 | Cytotoxicity assay | IC50 = 0.004 μM | 20930123 | |||
| HCT116 | Cytotoxicity assay | IC50 = 0.005 μM | 19691349 | |||
| MES-SA | Cytotoxicity assay | 3 days | IC50 = 0.005 μM | 21711054 | ||
| HCT116 | Cytotoxicity assay | 24 hrs | LD50 = 0.005 μM | 24786915 | ||
| RAW264.7 | Cytotoxicity assay | 24 hrs | LD50 = 0.005 μM | 24786915 | ||
| PC3 | Cytotoxicity assay | 5 days | GI50 = 0.006 μM | 19929004 | ||
| HCT116 | Antiproliferative assay | 72 hrs | IC50 = 0.006 μM | 20873740 | ||
| K562 | Cytotoxicity assay | 3 days | IC50 = 0.006 μM | 21711054 | ||
| CT26 | Cytotoxicity assay | 3 days | IC50 = 0.006 μM | 21711054 | ||
| BxPC3 | Growth inhibition assay | 96 hrs | IC50 = 0.006 μM | 29356532 | ||
| MRC5 | Cytotoxicity assay | 48 hrs | IC50 = 0.0063 μM | 25874330 | ||
| A549 | Cytotoxicity assay | 48 hrs | IC50 = 0.0068 μM | 25874330 | ||
| MRC5 | Cytotoxicity assay | 24 hrs | IC50 = 0.0068 μM | 25874330 | ||
| T24 | Cytotoxicity assay | 48 hrs | IC50 = 0.0069 μM | 25874330 | ||
| EL4 | Cytotoxicity assay | 3 days | IC50 = 0.007 μM | 21711054 | ||
| L1210 | Cytotoxicity assay | 3 days | IC50 = 0.007 μM | 21711054 | ||
| MCF7 | Cytotoxicity assay | 2 days | IC50 = 0.0072 μM | 24341356 | ||
| NCI-H460 | Cytotoxicity assay | IC50 = 0.0078 μM | 11728191 | |||
| BT549 | Cytotoxicity assay | 3 days | IC50 = 0.008 μM | 21711054 | ||
| MOLT4 | Cytotoxicity assay | 24 hrs | LD50 = 0.008 μM | 24786915 | ||
| BxPC3 | Growth inhibition assay | 48 hrs | LC50 = 0.00871 μM | 23094992 | ||
| DMS53 | Antiproliferative assay | 72 hrs | IC50 = 0.009 μM | 22861499 | ||
| MES-SA | Cytotoxicity assay | IC50 = 0.0092 μM | 11728191 | |||
| HCT116 | Antiproliferative assay | 72 hrs | IC50 = 0.0097 μM | 18469809 | ||
| HCT15 | Antiproliferative assay | 72 hrs | IC50 = 0.0099 μM | 18469809 | ||
| HeLa | Cytotoxicity assay | 4 days | IC50 = 0.0099 μM | 24341356 | ||
| H460 | Growth inhibition assay | IC50 = 0.01 μM | 17602464 | |||
| MCF7 | Antitumor assay | 48 hrs | GI50 = 0.01 μM | 18588281 | ||
| SF268 | Antiproliferative assay | 72 hrs | IC50 = 0.01 μM | 20873740 | ||
| HCT15 | Antiproliferative assay | 72 hrs | IC50 = 0.01 μM | 20873740 | ||
| BxPC3 | Cytotoxicity assay | 5 days | EC50 = 0.01 μM | 24867590 | ||
| SF268 | Antiproliferative assay | 72 hrs | IC50 = 0.0103 μM | 18469809 | ||
| MDA-MB-231 | Antiproliferative assay | IC50 = 0.0114 μM | 17887663 | |||
| Jurkat | Cytotoxicity assay | 24 hrs | LD50 = 0.012 μM | 24786915 | ||
| H292 | Growth inhibition assay | IC50 = 0.013 μM | 17602464 | |||
| L1210 | Cytotoxicity assay | 2 days | IC50 = 0.013 μM | 24341356 | ||
| L1210 | Cytotoxicity assay | 48 hrs | IC50 = 0.013 μM | 24471998 | ||
| SW480 | Antiproliferative assay | 72 hrs | IC50 = 0.0136 μM | 18469809 | ||
| A549 | Growth inhibition assay | IC50 = 0.014 μM | 17602464 | |||
| A2780 | Growth inhibition assay | IC50 = 0.015 μM | 17602464 | |||
| SW1573 | Growth inhibition assay | IC50 = 0.016 μM | 17602464 | |||
| A2780 | Antiproliferative assay | 72 hrs | IC50 = 0.0166 μM | 18469809 | ||
| T24 | Cytotoxicity assay | 24 hrs | IC50 = 0.017 μM | 25874330 | ||
| T24 | Cytotoxicity assay | 24 hrs | IC50 = 0.018 μM | 25874330 | ||
| P388D1 | Cytotoxicity assay | 3 days | IC50 = 0.019 μM | 21711054 | ||
| Capan1 | Growth inhibition assay | 96 hrs | IC50 = 0.019 μM | 29356532 | ||
| SF539 | Antiproliferative assay | 72 hrs | IC50 = 0.0198 μM | 18469809 | ||
| SF539 | Antiproliferative assay | 72 hrs | IC50 = 0.02 μM | 20873740 | ||
| A549 | Antiproliferative assay | 72 hrs | IC50 = 0.02 μM | 22861499 | ||
| CCRF-CEM | Cytotoxicity assay | 72 hrs | IC50 = 0.02 μM | 28221790 | ||
| MRC5 | Cytotoxicity assay | 24 hrs | IC50 = 0.0216 μM | 25874330 | ||
| CEM-DNR-bulk | Cytotoxicity assay | 3 days | IC50 = 0.022 μM | 21711054 | ||
| Jurkat | Cytotoxicity assay | 72 hrs | EC50 = 0.023 μM | 27032331 | ||
| HeLa | Cytotoxicity assay | 24 hrs | LD50 = 0.023 μM | 24786915 | ||
| MDA-MB-231 | Antiproliferative assay | 48 hrs | IC50 = 0.025 μM | 25350923 | ||
| U373-MAGI | Antiviral assay | 2 hrs | EC50 = 0.0275 μM | 24120088 | ||
| A549 | Cytotoxicity assay | 24 hrs | IC50 = 0.029 μM | 25874330 | ||
| HT29 | Antitumor assay | 48 hrs | GI50 = 0.03 μM | 18588281 | ||
| Jurkat | Antiproliferative assay | 72 hrs | IC50 = 0.03 μM | 20873740 | ||
| HCT116 | Cytotoxicity assay | 72 hrs | IC50 = 0.03 μM | 28221790 | ||
| MDA-MB-231 | Growth inhibition assay | 72 hrs | IC50 = 0.03 μM | 29253340 | ||
| HCT116 | Growth inhibition assay | 72 hrs | IC50 = 0.03 μM | 29253340 | ||
| A2780 | Antiproliferative assay | 72 hrs | IC50 = 0.035 μM | 20873740 | ||
| DU-145 | Cytotoxicity assay | IC50 = 0.0356 μM | 11728191 | |||
| MIAPaCa2 | Growth inhibition assay | 48 hrs | GI50 = 0.03583 μM | 23094992 | ||
| MDA-MB-231 | Antiproliferative assay | 48 hrs | IC50 = 0.0364 μM | 29795767 | ||
| PC3 | Cytotoxicity assay | IC50 = 0.04 μM | 19691349 | |||
| Jurkat | Antiproliferative assay | 72 hrs | IC50 = 0.0453 μM | 18469809 | ||
| HeLa | Cytotoxicity assay | 72 hrs | IC50 = 0.05 μM | 22944119 | ||
| K562 | Cytotoxicity assay | 48 hrs | IC50 = 0.05 μM | 24631359 | ||
| A549 | Cytotoxicity assay | 72 hrs | IC50 = 0.05 μM | 28221790 | ||
| K562-TAX | Cytotoxicity assay | 72 hrs | IC50 = 0.05 μM | 28221790 | ||
| COLO205 | Antiproliferative assay | 72 hrs | IC50 = 0.0514 μM | 18469809 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | IC50 = 0.06 μM | 22944119 | ||
| MIAPaCa2 | Cytotoxicity assay | 72 hrs | IC50 = 0.06 μM | 22944119 | ||
| PC3 | Cytotoxicity assay | 72 hrs | EC50 = 0.065 μM | 27032331 | ||
| CEM | Cytotoxicity assay | 3 days | IC50 = 0.069 μM | 24341356 | ||
| HPAC | Cytotoxicity assay | 3 days | IC50 = 0.073 μM | 21711054 | ||
| MCF7 | Antiproliferative assay | 72 hrs | IC50 = 0.08 μM | 20873740 | ||
| MCF7 | Antiproliferative assay | 72 hrs | IC50 = 0.0803 μM | 18469809 | ||
| CEM | Cytotoxicity assay | 72 hrs | IC50 = 0.086 μM | 24471998 | ||
| A549 | Cytotoxicity assay | IC50 = 0.09 μM | 19691349 | |||
| U2OS | Antiproliferative assay | 72 hrs | IC50 = 0.0907 μM | 18469809 | ||
| HuH7 | Cytotoxicity assay | CC50 = 0.1 μM | 20580554 | |||
| K562 | Cytotoxicity assay | 72 hrs | IC50 = 0.1 μM | 28221790 | ||
| CEM-DNR-bulk | Cytotoxicity assay | 72 hrs | IC50 = 0.1 μM | 28221790 | ||
| MIAPaCa2 | Growth inhibition assay | 48 hrs | LC50 = 0.1 μM | 23094992 | ||
| H460 | Growth inhibition assay | IC50 = 0.103 μM | 17602464 | |||
| RT112 | Cytotoxicity assay | EC50 = 0.1049 μM | 24471998 | |||
| PANC1 | Cytotoxicity assay | 48 hrs | IC50 = 0.11 μM | 22342146 | ||
| MIAPaCa2 | Cytotoxicity assay | 72 hrs | IC50 = 0.11 μM | 29328656 | ||
| MIAPaCa2 | Antiproliferative assay | 70 hrs | IC50 = 0.12 μM | 29471119 | ||
| CEM | Growth inhibition assay | IC50 = 0.13 μM | 17602464 | |||
| MCF7 | Cytotoxicity assay | 3 days | IC50 = 0.149 μM | 21711054 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | IC50 = 0.15 μM | 26025875 | ||
| CaCo2 | Antitumor assay | 48 hrs | GI50 = 0.18 μM | 18588281 | ||
| U2OS | Antiproliferative assay | 72 hrs | IC50 = 0.18 μM | 20873740 | ||
| U2OS | Cytotoxicity assay | 72 hrs | IC50 = 0.18 μM | 28221790 | ||
| MDA-MB-231 | Cytotoxicity assay | 24 hrs | IC50 = 0.19 μM | 25703296 | ||
| H292 | Growth inhibition assay | IC50 = 0.21 μM | 17602464 | |||
| A549 | Growth inhibition assay | IC50 = 0.225 μM | 17602464 | |||
| NCI-H460 | Cytotoxicity assay | 48 hrs | IC50 = 0.23 μM | 22342146 | ||
| MDA-MB-231 | Cytotoxicity assay | 3 days | IC50 = 0.245 μM | 21711054 | ||
| SW1573 | Growth inhibition assay | IC50 = 0.275 μM | 17602464 | |||
| A2780 | Cytotoxicity assay | 72 hrs | IC50 = 0.31 μM | 19362474 | ||
| K562 | Antitumor assay | 48 hrs | GI50 = 0.32 μM | 18588281 | ||
| HCT116 | Cytotoxicity assay | 48 hrs | IC50 = 0.32 μM | 22342146 | ||
| CFPAC-1 | Cytotoxicity assay | 96 hrs | IC50 = 0.35 μM | 24631359 | ||
| PANC1 | Cytotoxicity assay | 72 hrs | IC50 = 0.4 μM | 29656202 | ||
| HCT116 | Cytotoxicity assay | 72 hrs | IC50 = 0.41 μM | 28221790 | ||
| CFPAC-1 | Cytotoxicity assay | 72 hrs | IC50 = 0.47 μM | 24631359 | ||
| ACHN | Cytotoxicity assay | 48 hrs | IC50 = 0.48 μM | 22342146 | ||
| HCT116-E6 | Antiproliferative assay | 72 hrs | IC50 = 0.5 μM | 20873740 | ||
| C6 | Cytotoxicity assay | 3 days | IC50 = 0.504 μM | 21711054 | ||
| LNCAP | Cytotoxicity assay | 3 days | IC50 = 0.512 μM | 21711054 | ||
| Calu1 | Cytotoxicity assay | 48 hrs | IC50 = 0.52 μM | 22342146 | ||
| HT-29 | Cytotoxicity assay | 72 hrs | IC50 = 0.52 μM | 26025875 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | IC50 = 0.57 μM | 28075592 | ||
| K562 | Antiproliferative assay | 72 hrs | IC50 = 0.6 μM | 20873740 | ||
| MIAPaCa2 | Cytotoxicity assay | 24 hrs | IC50 = 0.6 μM | 25703296 | ||
| MDA-MB-231 | Cytotoxicity assay | 72 hrs | IC50 = 0.65 μM | 26025875 | ||
| BxPC3 | Cytotoxicity assay | 72 hrs | IC50 = 0.67 μM | 24471998 | ||
| K562 | Cytotoxicity assay | 3 days | IC50 = 0.718 μM | 21711054 | ||
| K562 | Antiproliferative assay | 72 hrs | IC50 = 0.7459 μM | 18469809 | ||
| Bel7402 | Cytotoxicity assay | 72 hrs | IC50 = 0.84 μM | 19362474 | ||
| HCT116/E6 | Antiproliferative assay | 72 hrs | IC50 = 0.8965 μM | 18469809 | ||
| HeLa | Cytotoxicity assay | 96 hrs | IC50 = 0.9 μM | 24631359 | ||
| CEM | Growth inhibition assay | IC50 = 1 μM | 17602464 | |||
| HB-1 | Antiviral assay | 24 hrs | EC50 = 1 μM | 20580554 | ||
| MIAPaCa2 | Cytotoxicity assay | 72 hrs | IC50 = 1.04 μM | 24471998 | ||
| SK-N-AS | Cytotoxicity assay | 3 days | IC50 = 1.1 μM | 21711054 | ||
| SW1990 | Cytotoxicity assay | 72 hrs | IC50 = 1.2 μM | 19362474 | ||
| A549 | Cytotoxicity assay | 72 hrs | IC50 = 1.4 μM | 19362474 | ||
| HepG2 | Function assay | Km = 1.4 μM | 17101674 | |||
| BL21(DE3) | Function assay | Km = 1.43 μM | 23230131 | |||
| U87MG | Cytotoxicity assay | 3 days | IC50 = 1.49 μM | 21711054 | ||
| BL21(DE3) | Function assay | Km = 1.52 μM | 23230131 | |||
| HT-29 | Cytotoxicity assay | 3 days | IC50 = 1.53 μM | 21711054 | ||
| SW1990 | Cytotoxicity assay | IC50 = 1.6 μM | 24195466 | |||
| Capan2 | Cytotoxicity assay | 72 hrs | IC50 = 1.7 μM | 19362474 | ||
| SW480 | Antiproliferative assay | 72 hrs | IC50 = 1.7 μM | 20873740 | ||
| PANC1 | Cytotoxicity assay | 72 hrs | IC50 = 1.7 μM | 29656202 | ||
| HCT8 | Cytotoxicity assay | 72 hrs | IC50 = 1.74 μM | 19362474 | ||
| BL21(DE3) | Function assay | Km = 1.75 μM | 23230131 | |||
| HT-29 | Cytotoxicity assay | 48 hrs | IC50 = 1.95 μM | 23968824 | ||
| MIAPaCa2 | Cytotoxicity assay | 5 days | EC50 = 2 μM | 24867590 | ||
| BL21(DE3) | Function assay | 1 min | Km = 2.15 μM | 23230131 | ||
| SW1990 | Cytotoxicity assay | IC50 = 2.2 μM | 25105722 | |||
| SW1990 | Cytotoxicity assay | 48 hrs | IC50 = 2.3 μM | 27966950 | ||
| NCI-H146 | Cytotoxicity assay | 3 days | IC50 = 2.78 μM | 21711054 | ||
| BxPC3 | Cytotoxicity assay | 72 hrs | IC50 = 2.9 μM | 19362474 | ||
| p53 deficient COLO205 | Antiproliferative assay | 72 hrs | IC50 = 3 μM | 20873740 | ||
| MiaPaCa | Cytotoxicity assay | 6 days | IC50 = 3 μM | 23360104 | ||
| COLO205 | Cytotoxicity assay | 48 hrs | IC50 = 3.24 μM | 23968824 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | IC50 = 3.28 μM | 19362474 | ||
| MIAPaCa2 | Cytotoxicity assay | 72 hrs | IC50 = 3.3 μM | 29328656 | ||
| HeLa | Cytotoxicity assay | 24 hrs | IC50 = 3.3 μM | 25703296 | ||
| FTC-133 | Cytotoxicity assay | 24 hrs | IC50 = 3.36 μM | 24436994 | ||
| BxPC3 | Growth inhibition assay | 48 hrs | GI50 = 3.64 μM | 22512908 | ||
| COLO320DM | Cytotoxicity assay | 48 hrs | IC50 = 3.92 μM | 23968824 | ||
| HeLa | Cytotoxicity assay | 3 days | IC50 = 4.12 μM | 21711054 | ||
| 8305C | Cytotoxicity assay | 24 hrs | IC50 = 4.53 μM | 24436994 | ||
| PANC1 | Cytotoxicity assay | 72 hrs | IC50 = 5.6 μM | 19362474 | ||
| PANC1 | Growth inhibition assay | 72 hrs | GI50 = 5.8 μM | 28495081 | ||
| SK-MEL-2 | Cytotoxicity assay | 3 days | IC50 = 7.11 μM | 21711054 | ||
| CEM | Cytotoxicity assay | 3 days | IC50 = 7.6 μM | 24341356 | ||
| SW1573 | Cytotoxicity assay | 72 hrs | IC50 = 8.3 μM | 17419604 | ||
| BxPC3 | Growth inhibition assay | 48 hrs | LC50 = 8.71 μM | 22512908 | ||
| MCF7 | Cytotoxicity assay | 72 hrs | IC50 = 8.9 μM | 28075592 | ||
| BJ | Cytotoxicity assay | 3 days | IC50 = 9.88 μM | 21711054 | ||
| HeLa | Cytotoxicity assay | 72 hrs | IC50 = 10 μM | 24631359 | ||
| B16-F10-Luc-G5 | Antiproliferative assay | 24 hrs | IC50 = 11 μM | 27349332 | ||
| HCT15 | Cytotoxicity assay | IC50 = 11.8 μM | 18186604 | |||
| A549 | Cytotoxicity assay | 72 hrs | IC50 = 13.1 μM | 17419604 | ||
| HCT116 | Cytotoxicity assay | IC50 = 14.3 μM | 18186604 | |||
| MiaPaCa | Cytotoxicity assay | 72 hrs | IC50 = 17.1 μM | 23489626 | ||
| AG6000 | Growth inhibition assay | IC50 = 20 μM | 17602464 | |||
| AG6000 | Growth inhibition assay | IC50 = 20 μM | 17602464 | |||
| BxPC3 | Antiproliferative assay | 72 hrs | IC50 = 20.2 μM | 28576633 | ||
| CV1 | Cytotoxicity assay | 72 hrs | IC50 = 21.9 μM | 23489626 | ||
| AsPC1 | Antiproliferative assay | 72 hrs | IC50 = 26.8 μM | 28576633 | ||
| PANC1 | Antiproliferative assay | 72 hrs | IC50 = 30.4 μM | 28576633 | ||
| MIAPaCa2 | Growth inhibition assay | 48 hrs | GI50 = 35.83 μM | 22512908 | ||
| Clicca per visualizzare più dati sperimentali sulle linee cellulari | ||||||
| Peso molecolare | 299.66 | Formula | C9H11F2N3O4.HCI |
Conservazione (Dalla data di ricezione) | |
|---|---|---|---|---|---|
| N. CAS | 122111-03-9 | Scarica SDF | Conservazione delle soluzioni stock |
|
|
| Sinonimi | NSC 613327 HCl,LY-188011 HCl | Smiles | C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F.Cl | ||
|
In vitro |
Water : 59 mg/mL
DMSO
: Insoluble
Ethanol : Insoluble |
|
In vivo |
|||||
Passo 1: Inserire le informazioni di seguito (Consigliato: Un animale aggiuntivo per tenere conto della perdita durante lesperimento)
Passo 2: Inserire la formulazione in vivo (Questo è solo il calcolatore, non la formulazione. Contattateci prima se non cè una formulazione in vivo nella sezione Solubilità.)
Risultati del calcolo:
Concentrazione di lavoro: mg/ml;
Metodo per preparare il liquido master di DMSO: mg farmaco predissolto in μL DMSO ( Concentrazione del liquido master mg/mL, Vi preghiamo di contattarci prima se la concentrazione supera la solubilità del DMSO del lotto del farmaco. )
Metodo per preparare la formulazione in vivo: Prendere μL DMSO liquido master, quindi aggiungereμL PEG300, mescolare e chiarire, quindi aggiungereμL Tween 80, mescolare e chiarire, quindi aggiungere μL ddH2O, mescolare e chiarire.
Metodo per preparare la formulazione in vivo: Prendere μL DMSO liquido master, quindi aggiungere μL Olio di mais, mescolare e chiarire.
Nota: 1. Si prega di assicurarsi che il liquido sia limpido prima di aggiungere il solvente successivo.
2. Assicurarsi di aggiungere il/i solvente/i in ordine. È necessario assicurarsi che la soluzione ottenuta, nellaggiunta precedente, sia una soluzione limpida prima di procedere allaggiunta del solvente successivo. Metodi fisici come il vortex, gli ultrasuoni o il bagno dacqua calda possono essere utilizzati per facilitare la dissoluzione.
| Caratteristiche |
Gemcitabine has been used to treat pancreatic cancer and has demonstrated effective anti-tumor activity.
|
|---|---|
| Targets/IC50/Ki |
DNA synthesis (Capan2 cells)
12 nM
DNA synthesis (BxPC3 cells)
18 nM
DNA synthesis (MIAPaCa2 cells)
40 nM
DNA synthesis (PANC1 cells)
50 nM
|
| In vitro |
La Gemcitabine ha indotto l'attività di NF-κB nelle cellule BxPC-3, PANC-1 e MIA PaCa-2 e ha diminuito il livello dell'inibitore di NF-κB IκBα nelle cellule BxPC-3 e PANC-1. Il trattamento delle cellule BxPC-3 con basse dosi di Gemcitabine per 48 ore si traduce in un aumento dose-dipendente del legame di NF-κB. Al contrario, il legame del DNA di NF-κB è diminuito nelle cellule BxPC-3 trattate con dosi più elevate di Gemcitabine per 48 ore; tuttavia, il trattamento di 24 ore con queste dosi più elevate aumenta il legame di NF-κB nelle cellule BxPC-3
|
| In vivo |
L'attività intratumorale di NF-κB è significativamente elevata (da 1,3 a 1,8 volte) nei topi trattati con Gemcitabine rispetto ai topi trattati con PBS, suggerendo che la Gemcitabine induce anche l'attivazione di NF-κB.
|
Riferimenti |
|
| Metodi | Biomarcatori | Immagini | PMID |
|---|---|---|---|
| Western blot | p70S6K1 / p-S6 / HIF-1α LC3-I / LC3-II pS-ERα / ERα / pERK / ERK caspase-3 / caspase-8 / caspase-9 p-JNK / JNK / p-ATF2 / p-c-Jun |
|
27765914 |
| Immunofluorescence | BMI1 |
|
27177084 |
| Growth inhibition assay | Cell viability |
|
27765914 |
(dati da https://clinicaltrials.gov, aggiornato il 2024-05-22)
| Numero NCT | Reclutamento | Condizioni | Sponsor/Collaboratori | Data di inizio | Fasi |
|---|---|---|---|---|---|
| NCT06320301 | Recruiting | Biliary Tract Cancer|Gemox Chemotherapy |
Sun Yat-Sen Memorial Hospital of Sun Yat-Sen University|Suzhou Suncadia Biopharmaceuticals Co. Ltd. |
April 1 2024 | Phase 2 |
| NCT06046794 | Not yet recruiting | Cancer Of Pancreas |
Institut Paoli-Calmettes |
February 1 2024 | Not Applicable |
| NCT06199466 | Recruiting | Metastatic Pancreatic Cancer |
M.D. Anderson Cancer Center|280Bio Inc |
January 22 2024 | Phase 1 |
| NCT06055348 | Not yet recruiting | Serous Ovarian Cancer|Advanced Ovarian Cancer |
Biocity Biopharmaceutics Co. Ltd. |
October 30 2023 | Phase 1|Phase 2 |
Istruzioni per la manipolazione
Tel: +1-832-582-8158 Ext:3
Per qualsiasi altra domanda, si prega di lasciare un messaggio.
Domanda 1:
What’s the difference between S1714 and S1149 and which one is better?
Risposta:
They have the same biological activities. The free base(S1714) dissolves better in DMSO, and it dissolves better in water.